C17H24BrF3N2O — CID 171171090
1-[(1R)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hexyl]piperazine (PubChem CID 171171090) has the molecular formula C17H24BrF3N2O and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-[(1R)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hexyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hexyl]piperazine |
|---|---|
| PubChem CID | 171171090 |
| Molecular Formula | C17H24BrF3N2O |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[(1R)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hexyl]piperazine |
| SMILES | CCCCC[C@H](c1cc(Br)cc(OC(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H24BrF3N2O/c1-2-3-4-5-16(23-8-6-22-7-9-23)13-10-14(18)12-15(11-13)24-17(19,20)21/h10-12,16,22H,2-9H2,1H3/t16-/m1/s1 |
| InChIKey | UHZICEVBCLEUQA-MRXNPFEDSA-N |
| XLogP | 4.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|