C18H25BrClF3N2O — CID 171165756
1-[(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride (PubChem CID 171165756) has the molecular formula C18H25BrClF3N2O and a molecular weight of 457.76 g/mol. Its IUPAC name is 1-[(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171165756 |
| Molecular Formula | C18H25BrClF3N2O |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-[(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@@H](c1cc(Br)cc(OC(F)(F)F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C18H24BrF3N2O.ClH/c1-2-3-4-5-6-17(24-9-7-23-8-10-24)14-11-15(19)13-16(12-14)25-18(20,21)22;/h2,11-13,17,23H,1,3-10H2;1H/t17-;/m0./s1 |
| InChIKey | KUSYXIINZQCWAG-LMOVPXPDSA-N |
| XLogP | 5.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|