C18H25F3N2O — CID 171172096
1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine (PubChem CID 171172096) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171172096 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(1R)-1-[3-(trifluoromethoxy)phenyl]hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@H](c1cccc(OC(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H25F3N2O/c1-2-3-4-5-9-17(23-12-10-22-11-13-23)15-7-6-8-16(14-15)24-18(19,20)21/h2,6-8,14,17,22H,1,3-5,9-13H2/t17-/m1/s1 |
| InChIKey | NJGFQBUFCSNPOY-QGZVFWFLSA-N |
| XLogP | 4.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|