C18H26F2N2O — CID 171165023
1-[(1S)-1-[4-(difluoromethoxy)phenyl]hept-6-enyl]piperazine (PubChem CID 171165023) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(1S)-1-[4-(difluoromethoxy)phenyl]hept-6-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[4-(difluoromethoxy)phenyl]hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171165023 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[(1S)-1-[4-(difluoromethoxy)phenyl]hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@@H](c1ccc(OC(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H26F2N2O/c1-2-3-4-5-6-17(22-13-11-21-12-14-22)15-7-9-16(10-8-15)23-18(19)20/h2,7-10,17-18,21H,1,3-6,11-14H2/t17-/m0/s1 |
| InChIKey | YBWGXEHSHYFLIW-KRWDZBQOSA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|