C18H26ClF3N2O2 — CID 171172155
2-[(1R)-1-piperazin-1-ylhept-6-enyl]-4-(trifluoromethoxy)phenol;hydrochloride (PubChem CID 171172155) has the molecular formula C18H26ClF3N2O2 and a molecular weight of 394.87 g/mol. Its IUPAC name is 2-[(1R)-1-piperazin-1-ylhept-6-enyl]-4-(trifluoromethoxy)phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-piperazin-1-ylhept-6-enyl]-4-(trifluoromethoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 171172155 |
| Molecular Formula | C18H26ClF3N2O2 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[(1R)-1-piperazin-1-ylhept-6-enyl]-4-(trifluoromethoxy)phenol;hydrochloride |
| SMILES | C=CCCCC[C@H](c1cc(OC(F)(F)F)ccc1O)N1CCNCC1.Cl |
| InChI | InChI=1S/C18H25F3N2O2.ClH/c1-2-3-4-5-6-16(23-11-9-22-10-12-23)15-13-14(7-8-17(15)24)25-18(19,20)21;/h2,7-8,13,16,22,24H,1,3-6,9-12H2;1H/t16-;/m1./s1 |
| InChIKey | SUOKEYZUDMTTEX-PKLMIRHRSA-N |
| XLogP | 4.41 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|