C18H28ClFN2O — CID 171163200
1-[(1S)-1-(2-fluoro-4-methoxyphenyl)hept-6-enyl]piperazine;hydrochloride (PubChem CID 171163200) has the molecular formula C18H28ClFN2O and a molecular weight of 342.89 g/mol. Its IUPAC name is 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163200 |
| Molecular Formula | C18H28ClFN2O |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@@H](c1ccc(OC)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C18H27FN2O.ClH/c1-3-4-5-6-7-18(21-12-10-20-11-13-21)16-9-8-15(22-2)14-17(16)19;/h3,8-9,14,18,20H,1,4-7,10-13H2,2H3;1H/t18-;/m0./s1 |
| InChIKey | ZGFVOCIAVIPKDO-FERBBOLQSA-N |
| XLogP | 3.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|