C16H25Cl2FN2O — CID 171274014
1-[(1S)-1-(2-fluoro-4-methoxyphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171274014) has the molecular formula C16H25Cl2FN2O and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274014 |
| Molecular Formula | C16H25Cl2FN2O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(1S)-1-(2-fluoro-4-methoxyphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1ccc(OC)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23FN2O.2ClH/c1-12(2)10-16(19-8-6-18-7-9-19)14-5-4-13(20-3)11-15(14)17;;/h4-5,11,16,18H,1,6-10H2,2-3H3;2*1H/t16-;;/m0../s1 |
| InChIKey | BPGDFUHLJFUGCI-SQKCAUCHSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|