C13H21ClN2O3 — CID 171183348
2-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-5-methoxyphenol;hydrochloride (PubChem CID 171183348) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is 2-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-5-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-5-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171183348 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-5-methoxyphenol;hydrochloride |
| SMILES | COc1ccc([C@H](CO)N2CCNCC2)c(O)c1.Cl |
| InChI | InChI=1S/C13H20N2O3.ClH/c1-18-10-2-3-11(13(17)8-10)12(9-16)15-6-4-14-5-7-15;/h2-3,8,12,14,16-17H,4-7,9H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | OXOVQJFPVASYIA-YDALLXLXSA-N |
| XLogP | 0.76 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|