C14H22N2O4 — CID 171183397
4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-3,5-dimethoxyphenol (PubChem CID 171183397) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-3,5-dimethoxyphenol.
| Compound Name | 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171183397 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(OC)c1[C@H](CO)N1CCNCC1 |
| InChI | InChI=1S/C14H22N2O4/c1-19-12-7-10(18)8-13(20-2)14(12)11(9-17)16-5-3-15-4-6-16/h7-8,11,15,17-18H,3-6,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | RHFAUDBEYVPQSU-NSHDSACASA-N |
| XLogP | 0.35 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |