C17H26N2O3 — CID 171291518
3,5-dimethoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol (PubChem CID 171291518) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3,5-dimethoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol.
| Compound Name | 3,5-dimethoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol |
|---|---|
| PubChem CID | 171291518 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3,5-dimethoxy-4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol |
| SMILES | C=CCC[C@H](c1c(OC)cc(O)cc1OC)N1CCNCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-5-6-14(19-9-7-18-8-10-19)17-15(21-2)11-13(20)12-16(17)22-3/h4,11-12,14,18,20H,1,5-10H2,2-3H3/t14-/m1/s1 |
| InChIKey | OGKITKBBZYFBMD-CQSZACIVSA-N |
| XLogP | 2.32 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|