C15H22N2O3 — CID 171297311
2-[(1R)-1-piperazin-1-ylpent-4-enyl]benzene-1,3,5-triol (PubChem CID 171297311) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[(1R)-1-piperazin-1-ylpent-4-enyl]benzene-1,3,5-triol.
| Compound Name | 2-[(1R)-1-piperazin-1-ylpent-4-enyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 171297311 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[(1R)-1-piperazin-1-ylpent-4-enyl]benzene-1,3,5-triol |
| SMILES | C=CCC[C@H](c1c(O)cc(O)cc1O)N1CCNCC1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-4-12(17-7-5-16-6-8-17)15-13(19)9-11(18)10-14(15)20/h2,9-10,12,16,18-20H,1,3-8H2/t12-/m1/s1 |
| InChIKey | NKHCURLQCXBNHM-GFCCVEGCSA-N |
| XLogP | 1.72 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|