C17H27BrCl2N2O — CID 171301191
4-bromo-3,5-dimethyl-2-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride (PubChem CID 171301191) has the molecular formula C17H27BrCl2N2O and a molecular weight of 426.23 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-2-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride.
| Compound Name | 4-bromo-3,5-dimethyl-2-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171301191 |
| Molecular Formula | C17H27BrCl2N2O |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-bromo-3,5-dimethyl-2-[(1R)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
| SMILES | C=CCC[C@H](c1c(O)cc(C)c(Br)c1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H25BrN2O.2ClH/c1-4-5-6-14(20-9-7-19-8-10-20)16-13(3)17(18)12(2)11-15(16)21;;/h4,11,14,19,21H,1,5-10H2,2-3H3;2*1H/t14-;;/m1../s1 |
| InChIKey | GORCHFUXYQSNSM-FMOMHUKBSA-N |
| XLogP | 4.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|