C17H28Cl2N2O3 — CID 171278932
3,5-dimethoxy-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride (PubChem CID 171278932) has the molecular formula C17H28Cl2N2O3 and a molecular weight of 379.33 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride.
| Compound Name | 3,5-dimethoxy-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171278932 |
| Molecular Formula | C17H28Cl2N2O3 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3,5-dimethoxy-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
| SMILES | C=CCC[C@@H](c1c(O)cc(OC)cc1OC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H26N2O3.2ClH/c1-4-5-6-14(19-9-7-18-8-10-19)17-15(20)11-13(21-2)12-16(17)22-3;;/h4,11-12,14,18,20H,1,5-10H2,2-3H3;2*1H/t14-;;/m0../s1 |
| InChIKey | VDLHMMMEMPOZIC-UTLKBRERSA-N |
| XLogP | 3.17 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|