C17H30Cl2N2O3 — CID 171305381
3,5-dimethoxy-2-[(1S)-2-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171305381) has the molecular formula C17H30Cl2N2O3 and a molecular weight of 381.34 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[(1S)-2-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 3,5-dimethoxy-2-[(1S)-2-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171305381 |
| Molecular Formula | C17H30Cl2N2O3 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3,5-dimethoxy-2-[(1S)-2-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1c(O)cc(OC)cc1OC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H28N2O3.2ClH/c1-5-12(2)17(19-8-6-18-7-9-19)16-14(20)10-13(21-3)11-15(16)22-4;;/h10-12,17-18,20H,5-9H2,1-4H3;2*1H/t12?,17-;;/m0../s1 |
| InChIKey | YVFMFYZNNQVZQH-ARDSSANDSA-N |
| XLogP | 3.25 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|