C16H25Cl2F3N2O3 — CID 171303773
3,5-dimethoxy-2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171303773) has the molecular formula C16H25Cl2F3N2O3 and a molecular weight of 421.29 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 3,5-dimethoxy-2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171303773 |
| Molecular Formula | C16H25Cl2F3N2O3 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3,5-dimethoxy-2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | COc1cc(O)c([C@@H](CCC(F)(F)F)N2CCNCC2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C16H23F3N2O3.2ClH/c1-23-11-9-13(22)15(14(10-11)24-2)12(3-4-16(17,18)19)21-7-5-20-6-8-21;;/h9-10,12,20,22H,3-8H2,1-2H3;2*1H/t12-;;/m1../s1 |
| InChIKey | MRKJIKZAWDAXRR-CURYUGHLSA-N |
| XLogP | 3.54 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|