C15H21F3N2O2 — CID 171167936
3-methoxy-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171167936) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-methoxy-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 3-methoxy-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171167936 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-methoxy-2-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | COc1cccc(O)c1[C@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H21F3N2O2/c1-22-13-4-2-3-12(21)14(13)11(5-6-15(16,17)18)20-9-7-19-8-10-20/h2-4,11,19,21H,5-10H2,1H3/t11-/m0/s1 |
| InChIKey | WXDNPJWGWANLQI-NSHDSACASA-N |
| XLogP | 2.69 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|