C16H26N2O2 — CID 171284147
2-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-3-methoxyphenol (PubChem CID 171284147) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-3-methoxyphenol.
| Compound Name | 2-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171284147 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-3-methoxyphenol |
| SMILES | COc1cccc(O)c1[C@@H](N1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-16(2,3)15(18-10-8-17-9-11-18)14-12(19)6-5-7-13(14)20-4/h5-7,15,17,19H,8-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | GRPQTEALDRQGEQ-OAHLLOKOSA-N |
| XLogP | 2.39 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|