C17H28N2O3 — CID 171273795
4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2,6-dimethoxyphenol (PubChem CID 171273795) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171273795 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc([C@@H](N2CCNCC2)C(C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C17H28N2O3/c1-17(2,3)16(19-8-6-18-7-9-19)12-10-13(21-4)15(20)14(11-12)22-5/h10-11,16,18,20H,6-9H2,1-5H3/t16-/m1/s1 |
| InChIKey | GKKLSEXQCHYZDC-MRXNPFEDSA-N |
| XLogP | 2.40 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |