C23H40N2O — CID 171272285
2,6-ditert-butyl-4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol (PubChem CID 171272285) has the molecular formula C23H40N2O and a molecular weight of 360.59 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol |
|---|---|
| PubChem CID | 171272285 |
| Molecular Formula | C23H40N2O |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 2,6-ditert-butyl-4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol |
| SMILES | CC(C)(C)c1cc([C@@H](N2CCNCC2)C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H40N2O/c1-21(2,3)17-14-16(15-18(19(17)26)22(4,5)6)20(23(7,8)9)25-12-10-24-11-13-25/h14-15,20,24,26H,10-13H2,1-9H3/t20-/m1/s1 |
| InChIKey | JZARYZMJQLUBFH-HXUWFJFHSA-N |
| XLogP | 4.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |