C23H34N2OS — CID 171284901
2,6-ditert-butyl-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171284901) has the molecular formula C23H34N2OS and a molecular weight of 386.61 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171284901 |
| Molecular Formula | C23H34N2OS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 2,6-ditert-butyl-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | CC(C)(C)c1cc([C@@H](c2cccs2)N2CCNCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H34N2OS/c1-22(2,3)17-14-16(15-18(21(17)26)23(4,5)6)20(19-8-7-13-27-19)25-11-9-24-10-12-25/h7-8,13-15,20,24,26H,9-12H2,1-6H3/t20-/m0/s1 |
| InChIKey | PLIITCAZUMPPPK-FQEVSTJZSA-N |
| XLogP | 5.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |