C15H16Cl2N2S — CID 171288405
1-[(S)-(3,5-dichlorophenyl)-thiophen-2-ylmethyl]piperazine (PubChem CID 171288405) has the molecular formula C15H16Cl2N2S and a molecular weight of 327.28 g/mol. Its IUPAC name is 1-[(S)-(3,5-dichlorophenyl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(S)-(3,5-dichlorophenyl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171288405 |
| Molecular Formula | C15H16Cl2N2S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-[(S)-(3,5-dichlorophenyl)-thiophen-2-ylmethyl]piperazine |
| SMILES | Clc1cc(Cl)cc([C@@H](c2cccs2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H16Cl2N2S/c16-12-8-11(9-13(17)10-12)15(14-2-1-7-20-14)19-5-3-18-4-6-19/h1-2,7-10,15,18H,3-6H2/t15-/m0/s1 |
| InChIKey | MIKMEPDQRQADNT-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |