C15H16Cl2N2OS — CID 171272195
2,4-dichloro-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171272195) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is 2,4-dichloro-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171272195 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2,4-dichloro-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H16Cl2N2OS/c16-10-8-11(15(20)12(17)9-10)14(13-2-1-7-21-13)19-5-3-18-4-6-19/h1-2,7-9,14,18,20H,3-6H2/t14-/m1/s1 |
| InChIKey | HWKZGQPDZNMGCU-CQSZACIVSA-N |
| XLogP | 3.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|