C15H20Cl2FN3OS — CID 171300977
2-amino-3-fluoro-6-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride (PubChem CID 171300977) has the molecular formula C15H20Cl2FN3OS and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride.
| Compound Name | 2-amino-3-fluoro-6-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171300977 |
| Molecular Formula | C15H20Cl2FN3OS |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-amino-3-fluoro-6-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Nc1c(F)ccc([C@@H](c2cccs2)N2CCNCC2)c1O |
| InChI | InChI=1S/C15H18FN3OS.2ClH/c16-11-4-3-10(15(20)13(11)17)14(12-2-1-9-21-12)19-7-5-18-6-8-19;;/h1-4,9,14,18,20H,5-8,17H2;2*1H/t14-;;/m0../s1 |
| InChIKey | KADAKUFGAOZWBJ-UTLKBRERSA-N |
| XLogP | 3.01 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|