C15H15F3N2S — CID 171180610
1-[(R)-thiophen-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine (PubChem CID 171180610) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[(R)-thiophen-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine.
| Compound Name | 1-[(R)-thiophen-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171180610 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[(R)-thiophen-2-yl-(2,4,5-trifluorophenyl)methyl]piperazine |
| SMILES | Fc1cc(F)c([C@H](c2cccs2)N2CCNCC2)cc1F |
| InChI | InChI=1S/C15H15F3N2S/c16-11-9-13(18)12(17)8-10(11)15(14-2-1-7-21-14)20-5-3-19-4-6-20/h1-2,7-9,15,19H,3-6H2/t15-/m1/s1 |
| InChIKey | ZQZXGKQCMCIAED-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|