C16H19FN2S — CID 3756282
1-[(2-fluorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 3756282) has the molecular formula C16H19FN2S and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(2-fluorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3756282 |
| Molecular Formula | C16H19FN2S |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(2-fluorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | Fc1ccccc1C(c1cccs1)N1CCCNCC1 |
| InChI | InChI=1S/C16H19FN2S/c17-14-6-2-1-5-13(14)16(15-7-3-12-20-15)19-10-4-8-18-9-11-19/h1-3,5-7,12,16,18H,4,8-11H2 |
| InChIKey | WCFNUYNRUXJFDE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |