C16H19ClN2S — CID 5096887
1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 5096887) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 5096887 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | Clc1ccc(C(c2cccs2)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C16H19ClN2S/c17-14-6-4-13(5-7-14)16(15-3-1-12-20-15)19-10-2-8-18-9-11-19/h1,3-7,12,16,18H,2,8-11H2 |
| InChIKey | TUHBBCQEHNXMQD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |