C15H19Cl3N2S — CID 171281575
1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171281575) has the molecular formula C15H19Cl3N2S and a molecular weight of 365.76 g/mol. Its IUPAC name is 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281575 |
| Molecular Formula | C15H19Cl3N2S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(C(c2cccs2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H17ClN2S.2ClH/c16-13-5-3-12(4-6-13)15(14-2-1-11-19-14)18-9-7-17-8-10-18;;/h1-6,11,15,17H,7-10H2;2*1H |
| InChIKey | MOFDXANFQOLNRW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |