C16H18Cl2N2S — CID 3844646
1-[(2,3-dichlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 3844646) has the molecular formula C16H18Cl2N2S and a molecular weight of 341.31 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(2,3-dichlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3844646 |
| Molecular Formula | C16H18Cl2N2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | Clc1cccc(C(c2cccs2)N2CCCNCC2)c1Cl |
| InChI | InChI=1S/C16H18Cl2N2S/c17-13-5-1-4-12(15(13)18)16(14-6-2-11-21-14)20-9-3-7-19-8-10-20/h1-2,4-6,11,16,19H,3,7-10H2 |
| InChIKey | QHFLXTSDHZFUCQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |