C17H17BrCl2N2 — CID 4267301
1-[(4-bromophenyl)-(2,3-dichlorophenyl)methyl]piperazine (PubChem CID 4267301) has the molecular formula C17H17BrCl2N2 and a molecular weight of 400.15 g/mol. Its IUPAC name is 1-[(4-bromophenyl)-(2,3-dichlorophenyl)methyl]piperazine.
| Compound Name | 1-[(4-bromophenyl)-(2,3-dichlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4267301 |
| Molecular Formula | C17H17BrCl2N2 |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 1-[(4-bromophenyl)-(2,3-dichlorophenyl)methyl]piperazine |
| SMILES | Clc1cccc(C(c2ccc(Br)cc2)N2CCNCC2)c1Cl |
| InChI | InChI=1S/C17H17BrCl2N2/c18-13-6-4-12(5-7-13)17(22-10-8-21-9-11-22)14-2-1-3-15(19)16(14)20/h1-7,17,21H,8-11H2 |
| InChIKey | RQHJTJLUNRYVJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |