C12H18Cl4N2 — CID 171277279
1-[(1S)-1-(2,3-dichlorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171277279) has the molecular formula C12H18Cl4N2 and a molecular weight of 332.10 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3-dichlorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,3-dichlorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277279 |
| Molecular Formula | C12H18Cl4N2 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1-[(1S)-1-(2,3-dichlorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | C[C@@H](c1cccc(Cl)c1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H16Cl2N2.2ClH/c1-9(16-7-5-15-6-8-16)10-3-2-4-11(13)12(10)14;;/h2-4,9,15H,5-8H2,1H3;2*1H/t9-;;/m0../s1 |
| InChIKey | CMEXVHOTHBZCAF-WWPIYYJJSA-N |
| XLogP | 3.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |