C16H26Cl4N2 — CID 171309076
1-[(1S)-1-(2,3-dichlorophenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171309076) has the molecular formula C16H26Cl4N2 and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3-dichlorophenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,3-dichlorophenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171309076 |
| Molecular Formula | C16H26Cl4N2 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[(1S)-1-(2,3-dichlorophenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@@H](c1cccc(Cl)c1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24Cl2N2.2ClH/c1-2-3-4-8-15(20-11-9-19-10-12-20)13-6-5-7-14(17)16(13)18;;/h5-7,15,19H,2-4,8-12H2,1H3;2*1H/t15-;;/m0../s1 |
| InChIKey | DTCZDILIXBWXIY-CKUXDGONSA-N |
| XLogP | 5.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|