C16H24Cl2N2 — CID 171310901
1-[(1R)-1-(2,3-dichlorophenyl)-4-methylpentyl]piperazine (PubChem CID 171310901) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-dichlorophenyl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,3-dichlorophenyl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171310901 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[(1R)-1-(2,3-dichlorophenyl)-4-methylpentyl]piperazine |
| SMILES | CC(C)CC[C@H](c1cccc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-12(2)6-7-15(20-10-8-19-9-11-20)13-4-3-5-14(17)16(13)18/h3-5,12,15,19H,6-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | NSOPDMOLKZRFGE-OAHLLOKOSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |