C16H23Cl3N2 — CID 171310469
1-[(1S)-4-methyl-1-(2,3,5-trichlorophenyl)pentyl]piperazine (PubChem CID 171310469) has the molecular formula C16H23Cl3N2 and a molecular weight of 349.73 g/mol. Its IUPAC name is 1-[(1S)-4-methyl-1-(2,3,5-trichlorophenyl)pentyl]piperazine.
| Compound Name | 1-[(1S)-4-methyl-1-(2,3,5-trichlorophenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171310469 |
| Molecular Formula | C16H23Cl3N2 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[(1S)-4-methyl-1-(2,3,5-trichlorophenyl)pentyl]piperazine |
| SMILES | CC(C)CC[C@@H](c1cc(Cl)cc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H23Cl3N2/c1-11(2)3-4-15(21-7-5-20-6-8-21)13-9-12(17)10-14(18)16(13)19/h9-11,15,20H,3-8H2,1-2H3/t15-/m0/s1 |
| InChIKey | OGQJLRYSMISAEA-HNNXBMFYSA-N |
| XLogP | 5.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|