C15H21Cl5N2 — CID 171295322
1-[(1R)-2-cyclopropyl-1-(2,3,5-trichlorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171295322) has the molecular formula C15H21Cl5N2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[(1R)-2-cyclopropyl-1-(2,3,5-trichlorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2-cyclopropyl-1-(2,3,5-trichlorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295322 |
| Molecular Formula | C15H21Cl5N2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 1-[(1R)-2-cyclopropyl-1-(2,3,5-trichlorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cc(Cl)c(Cl)c([C@@H](CC2CC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H19Cl3N2.2ClH/c16-11-8-12(15(18)13(17)9-11)14(7-10-1-2-10)20-5-3-19-4-6-20;;/h8-10,14,19H,1-7H2;2*1H/t14-;;/m1../s1 |
| InChIKey | OOSVNEBLNOJWID-FMOMHUKBSA-N |
| XLogP | 5.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|