C13H18Cl4N2O — CID 171189293
(3R)-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol;hydrochloride (PubChem CID 171189293) has the molecular formula C13H18Cl4N2O and a molecular weight of 360.11 g/mol. Its IUPAC name is (3R)-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171189293 |
| Molecular Formula | C13H18Cl4N2O |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (3R)-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.OCC[C@H](c1cc(Cl)cc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H17Cl3N2O.ClH/c14-9-7-10(13(16)11(15)8-9)12(1-6-19)18-4-2-17-3-5-18;/h7-8,12,17,19H,1-6H2;1H/t12-;/m1./s1 |
| InChIKey | XHLKZBFZXDWHLY-UTONKHPSSA-N |
| XLogP | 3.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|