C13H18Cl2F2N2O — CID 171173923
(3R)-3-(2-chloro-3,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride (PubChem CID 171173923) has the molecular formula C13H18Cl2F2N2O and a molecular weight of 327.20 g/mol. Its IUPAC name is (3R)-3-(2-chloro-3,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (3R)-3-(2-chloro-3,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171173923 |
| Molecular Formula | C13H18Cl2F2N2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (3R)-3-(2-chloro-3,6-difluorophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride |
| SMILES | Cl.OCC[C@H](c1c(F)ccc(F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H17ClF2N2O.ClH/c14-13-10(16)2-1-9(15)12(13)11(3-8-19)18-6-4-17-5-7-18;/h1-2,11,17,19H,3-8H2;1H/t11-;/m1./s1 |
| InChIKey | GNZYIHMOXMBCJI-RFVHGSKJSA-N |
| XLogP | 2.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|