C12H16Cl3F3N2 — CID 171292643
1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride (PubChem CID 171292643) has the molecular formula C12H16Cl3F3N2 and a molecular weight of 351.63 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292643 |
| Molecular Formula | C12H16Cl3F3N2 |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@H](c1c(F)ccc(F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H14ClF3N2.2ClH/c13-12-9(16)2-1-8(15)11(12)10(7-14)18-5-3-17-4-6-18;;/h1-2,10,17H,3-7H2;2*1H/t10-;;/m1../s1 |
| InChIKey | LAWSFBFJONFLCT-YQFADDPSSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|