C12H14ClF3N2 — CID 171182007
1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine (PubChem CID 171182007) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182007 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethyl]piperazine |
| SMILES | FC[C@H](c1c(F)ccc(F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H14ClF3N2/c13-12-9(16)2-1-8(15)11(12)10(7-14)18-5-3-17-4-6-18/h1-2,10,17H,3-7H2/t10-/m1/s1 |
| InChIKey | FNWHDJHSNSUVEG-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|