C12H16Cl2F4N2 — CID 171277668
1-[(1R)-2-fluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171277668) has the molecular formula C12H16Cl2F4N2 and a molecular weight of 335.17 g/mol. Its IUPAC name is 1-[(1R)-2-fluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2-fluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277668 |
| Molecular Formula | C12H16Cl2F4N2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-[(1R)-2-fluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@@H](c1c(F)ccc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C12H14F4N2.2ClH/c13-7-10(18-5-3-17-4-6-18)11-8(14)1-2-9(15)12(11)16;;/h1-2,10,17H,3-7H2;2*1H/t10-;;/m0../s1 |
| InChIKey | XXJPBVONQSATAX-XRIOVQLTSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|