C12H17BrCl2F2N2O — CID 171297966
6-bromo-3-fluoro-2-[(1R)-2-fluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride (PubChem CID 171297966) has the molecular formula C12H17BrCl2F2N2O and a molecular weight of 394.09 g/mol. Its IUPAC name is 6-bromo-3-fluoro-2-[(1R)-2-fluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride.
| Compound Name | 6-bromo-3-fluoro-2-[(1R)-2-fluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171297966 |
| Molecular Formula | C12H17BrCl2F2N2O |
| Molecular Weight | 394.09 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 6-bromo-3-fluoro-2-[(1R)-2-fluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(Br)ccc(F)c1[C@H](CF)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrF2N2O.2ClH/c13-8-1-2-9(15)11(12(8)18)10(7-14)17-5-3-16-4-6-17;;/h1-2,10,16,18H,3-7H2;2*1H/t10-;;/m0../s1 |
| InChIKey | HKEREGIXZKZWDN-XRIOVQLTSA-N |
| XLogP | 3.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|