C12H15BrF2N2O — CID 171173640
(2S)-2-(3-bromo-2,6-difluorophenyl)-2-piperazin-1-ylethanol (PubChem CID 171173640) has the molecular formula C12H15BrF2N2O and a molecular weight of 321.17 g/mol. Its IUPAC name is (2S)-2-(3-bromo-2,6-difluorophenyl)-2-piperazin-1-ylethanol.
| Compound Name | (2S)-2-(3-bromo-2,6-difluorophenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 171173640 |
| Molecular Formula | C12H15BrF2N2O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (2S)-2-(3-bromo-2,6-difluorophenyl)-2-piperazin-1-ylethanol |
| SMILES | OC[C@H](c1c(F)ccc(Br)c1F)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrF2N2O/c13-8-1-2-9(14)11(12(8)15)10(7-18)17-5-3-16-4-6-17/h1-2,10,16,18H,3-7H2/t10-/m1/s1 |
| InChIKey | BRVIIKWPXQTOLH-SNVBAGLBSA-N |
| XLogP | 1.67 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|