C13H16BrClF4N2 — CID 171179550
1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3-difluoropropyl]piperazine;hydrochloride (PubChem CID 171179550) has the molecular formula C13H16BrClF4N2 and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3-difluoropropyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3-difluoropropyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171179550 |
| Molecular Formula | C13H16BrClF4N2 |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3-difluoropropyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(Br)c(F)c1[C@H](CC(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H15BrF4N2.ClH/c14-8-1-2-9(15)12(13(8)18)10(7-11(16)17)20-5-3-19-4-6-20;/h1-2,10-11,19H,3-7H2;1H/t10-;/m0./s1 |
| InChIKey | BAAWEKUHKGXCGT-PPHPATTJSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|