C13H14BrF5N2 — CID 171164711
1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171164711) has the molecular formula C13H14BrF5N2 and a molecular weight of 373.16 g/mol. Its IUPAC name is 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171164711 |
| Molecular Formula | C13H14BrF5N2 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | Fc1ccc(Br)c(F)c1[C@H](CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H14BrF5N2/c14-8-1-2-9(15)11(12(8)16)10(7-13(17,18)19)21-5-3-20-4-6-21/h1-2,10,20H,3-7H2/t10-/m0/s1 |
| InChIKey | FKPOVNPUAIQUJR-JTQLQIEISA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|