C15H22BrClF2N2 — CID 171170030
1-[(1R)-1-(3-bromo-2,6-difluorophenyl)-3-methylbutyl]piperazine;hydrochloride (PubChem CID 171170030) has the molecular formula C15H22BrClF2N2 and a molecular weight of 383.71 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)-3-methylbutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)-3-methylbutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170030 |
| Molecular Formula | C15H22BrClF2N2 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)-3-methylbutyl]piperazine;hydrochloride |
| SMILES | CC(C)C[C@H](c1c(F)ccc(Br)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H21BrF2N2.ClH/c1-10(2)9-13(20-7-5-19-6-8-20)14-12(17)4-3-11(16)15(14)18;/h3-4,10,13,19H,5-9H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | XUOZRBFWCSFQLI-BTQNPOSSSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|