C12H15BrF2N2 — CID 171169983
1-[(1R)-1-(3-bromo-2,6-difluorophenyl)ethyl]piperazine (PubChem CID 171169983) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171169983 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-[(1R)-1-(3-bromo-2,6-difluorophenyl)ethyl]piperazine |
| SMILES | C[C@H](c1c(F)ccc(Br)c1F)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrF2N2/c1-8(17-6-4-16-5-7-17)11-10(14)3-2-9(13)12(11)15/h2-3,8,16H,4-7H2,1H3/t8-/m1/s1 |
| InChIKey | SKYYTQKUIMJJOV-MRVPVSSYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|