C12H13BrF4N2 — CID 171290317
1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]piperazine (PubChem CID 171290317) has the molecular formula C12H13BrF4N2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 171290317 |
| Molecular Formula | C12H13BrF4N2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-[(1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]piperazine |
| SMILES | Fc1ccc(Br)c(F)c1[C@@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C12H13BrF4N2/c13-7-1-2-8(14)9(10(7)15)11(12(16)17)19-5-3-18-4-6-19/h1-2,11-12,18H,3-6H2/t11-/m0/s1 |
| InChIKey | GNDBDOBVOMCABV-NSHDSACASA-N |
| XLogP | 2.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|