C12H16Cl2F4N2O — CID 171297604
2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3,6-difluorophenol;dihydrochloride (PubChem CID 171297604) has the molecular formula C12H16Cl2F4N2O and a molecular weight of 351.17 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3,6-difluorophenol;dihydrochloride.
| Compound Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3,6-difluorophenol;dihydrochloride |
|---|---|
| PubChem CID | 171297604 |
| Molecular Formula | C12H16Cl2F4N2O |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3,6-difluorophenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(F)ccc(F)c1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C12H14F4N2O.2ClH/c13-7-1-2-8(14)11(19)9(7)10(12(15)16)18-5-3-17-4-6-18;;/h1-2,10,12,17,19H,3-6H2;2*1H/t10-;;/m1../s1 |
| InChIKey | ROYWGEWEJJEXIE-YQFADDPSSA-N |
| XLogP | 2.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|