C12H15Cl2F5N2 — CID 171277667
1-[(1R)-2,2-difluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171277667) has the molecular formula C12H15Cl2F5N2 and a molecular weight of 353.16 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-difluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277667 |
| Molecular Formula | C12H15Cl2F5N2 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-(2,3,6-trifluorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(F)c([C@H](C(F)F)N2CCNCC2)c1F |
| InChI | InChI=1S/C12H13F5N2.2ClH/c13-7-1-2-8(14)10(15)9(7)11(12(16)17)19-5-3-18-4-6-19;;/h1-2,11-12,18H,3-6H2;2*1H/t11-;;/m1../s1 |
| InChIKey | ULDJRVULQCQNSO-NVJADKKVSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|