C13H16ClF3N2 — CID 171169964
1-[(1R)-1-(2,3,6-trifluorophenyl)prop-2-enyl]piperazine;hydrochloride (PubChem CID 171169964) has the molecular formula C13H16ClF3N2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3,6-trifluorophenyl)prop-2-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,3,6-trifluorophenyl)prop-2-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171169964 |
| Molecular Formula | C13H16ClF3N2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[(1R)-1-(2,3,6-trifluorophenyl)prop-2-enyl]piperazine;hydrochloride |
| SMILES | C=C[C@H](c1c(F)ccc(F)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H15F3N2.ClH/c1-2-11(18-7-5-17-6-8-18)12-9(14)3-4-10(15)13(12)16;/h2-4,11,17H,1,5-8H2;1H/t11-;/m1./s1 |
| InChIKey | NKBGBFRZVBXUMT-RFVHGSKJSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|