C14H20ClFN2O — CID 171166798
1-[(1S)-1-(2-fluoro-6-methoxyphenyl)prop-2-enyl]piperazine;hydrochloride (PubChem CID 171166798) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 1-[(1S)-1-(2-fluoro-6-methoxyphenyl)prop-2-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-fluoro-6-methoxyphenyl)prop-2-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166798 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[(1S)-1-(2-fluoro-6-methoxyphenyl)prop-2-enyl]piperazine;hydrochloride |
| SMILES | C=C[C@@H](c1c(F)cccc1OC)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H19FN2O.ClH/c1-3-12(17-9-7-16-8-10-17)14-11(15)5-4-6-13(14)18-2;/h3-6,12,16H,1,7-10H2,2H3;1H/t12-;/m0./s1 |
| InChIKey | LFWHAKVTPRSPAF-YDALLXLXSA-N |
| XLogP | 2.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|